216699-86-4 Usage
Uses
Used in Pharmaceutical Development:
2-Chloro-6,7-dimethoxyquinoxaline is used as a chemical intermediate for the synthesis of various pharmaceuticals and therapeutic compounds. Its unique structure, featuring a chloro and methoxy groups, may contribute to the development of new drugs with potential applications in different medical fields.
Used in Research and Development:
In the scientific community, 2-Chloro-6,7-dimethoxyquinoxaline serves as a valuable research compound for studying the properties and potential applications of quinoxaline derivatives. Its synthesis and modification can lead to the discovery of new compounds with improved pharmacological properties and therapeutic effects.
Used in Chemical Synthesis:
2-Chloro-6,7-dimethoxyquinoxaline is used as a key building block in the synthesis of more complex organic molecules. Its reactivity and structural features make it a suitable candidate for further chemical reactions, potentially leading to the creation of novel compounds with diverse applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 216699-86-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,6,6,9 and 9 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 216699-86:
(8*2)+(7*1)+(6*6)+(5*6)+(4*9)+(3*9)+(2*8)+(1*6)=174
174 % 10 = 4
So 216699-86-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClN2O2/c1-14-8-3-6-7(4-9(8)15-2)13-10(11)5-12-6/h3-5H,1-2H3
216699-86-4Relevant academic research and scientific papers
He, Wei,Myers, Michael R.,Hanney, Barbara,Spada, Alfred P.,Bilder, Glenda,Galzcinski, Helen,Amin, Dilip,Needle, Saul,Page, Ken,Jayyosi, Zaid,Perrone, Mark H.
, p. 3097 - 3100 (2003)
RPR127963 demonstrates an excellent pharmacokinetic profile in several species and was found to be efficacious in the prevention of restenosis in a Yucatan mini-pig model upon oral administration of 1-5 mg/kg. The in vitro selectivity profile and SAR of t