221287-88-3 Usage
Description
Methyl 1-((2-Benzyloxycarbonyl)phenyl)-2,3,4-tri-O-acetyl-D-glucopyranuronate is a complex organic compound with a unique chemical structure. It is characterized by a methyl group, a benzyloxycarbonyl-phenyl moiety, and a D-glucopyranuronate backbone with three acetyl groups attached to the 2, 3, and 4 positions. Methyl 1-((2-Benzyloxycarbonxyl)phenyl)-2,3,4-tri-O-acetyl--D-glucopyranuronate is a white powder and serves as an intermediate in the synthesis of the metabolite of Nitazoxanide, a drug used to treat various parasitic infections.
Uses
Used in Pharmaceutical Industry:
Methyl 1-((2-Benzyloxycarbonyl)phenyl)-2,3,4-tri-O-acetyl-D-glucopyranuronate is used as an intermediate in the synthesis of the metabolite of Nitazoxanide for its role in the treatment of parasitic infections. Its unique chemical structure allows for the development of new drugs and therapies to combat various diseases caused by parasites.
Used in Chemical Research:
As a complex organic compound, Methyl 1-((2-Benzyloxycarbonyl)phenyl)-2,3,4-tri-O-acetyl-D-glucopyranuronate can be utilized in chemical research to study its properties, reactivity, and potential applications in various fields. Its synthesis and modification can lead to the discovery of new compounds with novel properties and uses.
Used in Drug Synthesis:
Methyl 1-((2-Benzyloxycarbonyl)phenyl)-2,3,4-tri-O-acetyl-D-glucopyranuronate is used as a key intermediate in the synthesis of various drugs, particularly those targeting parasitic infections. Its unique structure and reactivity make it a valuable component in the development of new pharmaceuticals with improved efficacy and reduced side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 221287-88-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,1,2,8 and 7 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 221287-88:
(8*2)+(7*2)+(6*1)+(5*2)+(4*8)+(3*7)+(2*8)+(1*8)=123
123 % 10 = 3
So 221287-88-3 is a valid CAS Registry Number.
InChI:InChI=1/C27H28O12/c1-15(28)35-21-22(36-16(2)29)24(37-17(3)30)27(39-23(21)26(32)33-4)38-20-13-9-8-12-19(20)25(31)34-14-18-10-6-5-7-11-18/h5-13,21-24,27H,14H2,1-4H3/t21-,22-,23?,24-,27+/m1/s1
221287-88-3Relevant articles and documents
Syntheses and antibacterial activities of tizoxanide, an /V-(Nitrothiazolyl)salicylamide, and its O-aryl glucuronidef
Rossignol, Jean-Francois,Stachulski, Andrew V.
, p. 44 - 45 (2007/10/03)
Mild hydrolysis of the broad-spectrum anaerobic antibacterial and antiparasitic agent nitazoxanide 1 affords tizoxanide 2, which is a major metabolite of 1 retaining most of its activity; further metabolism of 2 leads to the 0-aryl glucuronide 3, efficien