2224-20-6 Usage
Uses
Used in Pharmaceutical Industry:
4-Methyl-1,3-diazinan-2-one is used as a key intermediate in the synthesis of active pharmaceutical ingredients. Its unique structure and properties make it a valuable building block for developing new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 4-Methyl-1,3-diazinan-2-one serves as a crucial component in the production of various agrochemicals. Its versatility in chemical reactions allows for the creation of compounds that can be used in crop protection, pest control, and other agricultural applications.
As a Synthesis Building Block:
4-Methyl-1,3-diazinan-2-one is utilized as a synthesis building block for the production of a wide range of chemicals. Its reactivity and compatibility with other chemical groups make it an essential component in the development of new chemical entities with diverse applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 2224-20-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,2,2 and 4 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 2224-20:
(6*2)+(5*2)+(4*2)+(3*4)+(2*2)+(1*0)=46
46 % 10 = 6
So 2224-20-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H10N2O/c1-4-2-3-6-5(8)7-4/h4H,2-3H2,1H3,(H2,6,7,8)
