225104-76-7 Usage
Uses
Used in Pharmaceutical Industry:
3-Chloro-2,6-difluorobenzoic acid is used as an intermediate in the synthesis of various pharmaceuticals. Its unique structural properties allow for the development of new drugs with improved efficacy and selectivity.
Used in Agrochemical Industry:
In the agrochemical industry, 3-chloro-2,6-difluorobenzoic acid is utilized as a building block for the synthesis of agrochemicals, such as pesticides and herbicides. Its presence in these compounds can enhance their performance and selectivity in controlling pests and weeds.
Used in Dye Industry:
3-Chloro-2,6-difluorobenzoic acid is used as a key intermediate in the production of various dyes. Its incorporation into dye molecules can result in improved color properties and stability.
Used in Organic Synthesis:
As a building block in organic synthesis, 3-chloro-2,6-difluorobenzoic acid is used to construct a wide range of organic compounds. Its functional groups and structural features facilitate the formation of diverse chemical entities for various applications.
Used in Chemical Research:
3-Chloro-2,6-difluorobenzoic acid serves as a reagent in chemical research, enabling the exploration of new reaction pathways and the development of innovative synthetic methods.
Used in Material Science and Polymer Chemistry:
Due to its functional and structural properties, 3-chloro-2,6-difluorobenzoic acid has potential applications in the field of material science and polymer chemistry. It can be incorporated into polymers to impart specific properties, such as enhanced thermal stability, mechanical strength, or chemical resistance.
Check Digit Verification of cas no
The CAS Registry Mumber 225104-76-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,5,1,0 and 4 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 225104-76:
(8*2)+(7*2)+(6*5)+(5*1)+(4*0)+(3*4)+(2*7)+(1*6)=97
97 % 10 = 7
So 225104-76-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H3ClF2O2/c8-3-1-2-4(9)5(6(3)10)7(11)12/h1-2H,(H,11,12)
225104-76-7Relevant academic research and scientific papers
Direct C–H Carboxylation Forming Polyfunctionalized Aromatic Carboxylic Acids by Combined Br?nsted Bases
Hanasaka, Kazuya,Izumi, Koki,Kondo, Yoshinori,Kwon, Eunsang,Nozawa-Kumada, Kanako,Shigeno, Masanori,Tohara, Itsuki,Yamakoshi, Hiroyuki
supporting information, p. 809 - 814 (2022/02/05)
CO2 fixation into electron-deficient aromatic C–H bonds proceeds with the combined Br?nsted bases LiO-t-Bu and LiO-t-Am/CsF/18-crown-6 (t-Am = CEtMe2) under a CO2 atmosphere to afford a variety of polyfunctionalized aromat
