22823-50-3 Usage
Uses
Used in Pharmaceutical Industry:
BOC-MET-OH DCHA is used as a key component in the synthesis of peptides and proteins for various pharmaceutical applications. Its role in protecting amino groups and aiding in the formation of amide bonds is crucial for the development of therapeutic peptides and proteins with specific biological activities.
Used in Biochemistry Research:
In biochemistry, BOC-MET-OH DCHA serves as a valuable tool for researchers studying protein structure and function. Its ability to facilitate the synthesis of peptides with specific sequences allows for the exploration of protein interactions and mechanisms at a molecular level.
Used in Peptide Synthesis:
BOC-MET-OH DCHA is used as a coupling agent in peptide synthesis to efficiently link amino acids together. This is essential for the production of custom peptides for use in drug discovery, diagnostics, and other applications where specific peptide sequences are required.
Used in Organic Synthesis:
Beyond its applications in peptide chemistry, BOC-MET-OH DCHA can also be utilized in broader organic synthesis processes. The BOC protecting group is particularly useful in protecting amino groups during reactions where such groups might otherwise interfere with the desired synthetic pathway.
Check Digit Verification of cas no
The CAS Registry Mumber 22823-50-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,8,2 and 3 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 22823-50:
(7*2)+(6*2)+(5*8)+(4*2)+(3*3)+(2*5)+(1*0)=93
93 % 10 = 3
So 22823-50-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H23N.C10H19NO4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-10(2,3)15-9(14)11-7(8(12)13)5-6-16-4/h11-13H,1-10H2;7H,5-6H2,1-4H3,(H,11,14)(H,12,13)/t;7-/m.0/s1
