2305-37-5 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
Benzoic acid, 3-amino-5-methyl(9CI), is used as a building block in the synthesis of pharmaceuticals and agrochemicals. Its chemical structure allows for the creation of various compounds with potential therapeutic and pesticidal properties.
Used in Dye and Pigment Production:
Benzoic acid, 3-amino-5-methyl(9CI) is utilized in the production of dyes and pigments due to its ability to impart color. Its chemical structure contributes to the color characteristics of the final products, making it a valuable component in this industry.
Used as an Antimicrobial Preservative:
Benzoic acid, 3-amino-5-methyl(9CI), exhibits antimicrobial properties, making it useful as a preservative in food and cosmetic products. Its ability to inhibit the growth of microorganisms helps maintain the quality and safety of these products.
Used in the Manufacturing of Plasticizers, Perfumes, and Flavors:
Benzoic acid, 3-amino-5-methyl(9CI) is employed in the production of plasticizers, perfumes, and flavors, where its chemical properties contribute to the desired characteristics of these products, such as flexibility, scent, and taste.
Used as a Precursor in Organic Synthesis:
Benzoic acid, 3-amino-5-methyl(9CI), serves as a precursor in the synthesis of other organic compounds. Its versatile chemical structure allows for further reactions and modifications, leading to the creation of a wide range of compounds for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 2305-37-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,3,0 and 5 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 2305-37:
(6*2)+(5*3)+(4*0)+(3*5)+(2*3)+(1*7)=55
55 % 10 = 5
So 2305-37-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO2/c1-5-2-6(8(10)11)4-7(9)3-5/h2-4H,9H2,1H3,(H,10,11)
