23284-85-7 Usage
Uses
Used in Pharmaceutical Industry:
AKOS BBS-00007303 is used as a synthetic intermediate for the development of various pharmaceutical compounds. Its ability to form substituted imidazoles, oxazoles, thiazoles, and diethyl pyrazine-2,5-dicarboxylate makes it a valuable asset in the synthesis of novel drugs with potential therapeutic applications.
Used in Chemical Research:
In the field of chemical research, AKOS BBS-00007303 is used as a key building block for the synthesis of complex organic molecules. Its versatility in forming different types of compounds allows researchers to explore new chemical structures and their potential applications in various industries.
Used in Material Science:
AKOS BBS-00007303 can be utilized in the development of new materials with specific properties, such as improved stability, reactivity, or selectivity. Its ability to form various substituted compounds can contribute to the creation of advanced materials for use in different applications, including electronics, coatings, and adhesives.
Used in Agrochemical Industry:
In the agrochemical industry, AKOS BBS-00007303 can be employed as a starting material for the synthesis of novel compounds with potential applications in pest control, crop protection, and other agricultural practices. Its versatility in forming different types of compounds can lead to the development of innovative and effective solutions for various challenges in agriculture.
Check Digit Verification of cas no
The CAS Registry Mumber 23284-85-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,2,8 and 4 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 23284-85:
(7*2)+(6*3)+(5*2)+(4*8)+(3*4)+(2*8)+(1*5)=107
107 % 10 = 7
So 23284-85-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO4/c1-2-16-10(13)7-12-9-5-3-8(4-6-9)11(14)15/h3-6,12H,2,7H2,1H3,(H,14,15)
