24048-74-6 Usage
General Description
6-METHYL-2,4-DIOXO-1,2,3,4-TETRAHYDRO-PYRIMIDINE-5-CARBALDEHYDE is a chemical compound with the molecular formula C6H7N3O3. It is a derivative of pyrimidine and is characterized by its aldehyde functional group. 6-METHYL-2,4-DIOXO-1,2,3,4-TETRAHYDRO-PYRIMIDINE-5-CARBALDEHYDE has potential applications in medicinal chemistry as a building block for the synthesis of biologically active molecules. Additionally, it may also be used in organic synthesis as a reagent or intermediate for the preparation of various other compounds. Its chemical structure and properties make it a valuable component in the development of pharmaceuticals and other fine chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 24048-74-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,0,4 and 8 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 24048-74:
(7*2)+(6*4)+(5*0)+(4*4)+(3*8)+(2*7)+(1*4)=96
96 % 10 = 6
So 24048-74-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N2O3/c1-3-4(2-9)5(10)8-6(11)7-3/h2H,1H3,(H2,7,8,10,11)
