253324-92-4 Usage
Uses
Used in Pharmaceutical Industry:
2H-3-Benzazepin-2-one, 1-amino-1,3,4,5-tetrahydro-3-methyl, (1S)is used as a building block and intermediate for the synthesis of pharmaceutical compounds. Its unique structure and chirality make it a valuable component in the development of central nervous system drugs, where it can be incorporated into various drug molecules to enhance their therapeutic effects and target specific receptors or pathways.
The specific application reasons for using 2H-3-Benzazepin-2-one, 1-amino-1,3,4,5-tetrahydro-3-methyl, (1S)in the pharmaceutical industry include:
1. Its chiral nature allows for the development of enantiomer-specific drugs, which can exhibit different pharmacological properties and reduce potential side effects.
2. Its structural features can be utilized to design drugs with improved binding affinity to target receptors, leading to increased potency and selectivity.
3. As a building block, it can be combined with other chemical moieties to create novel drug candidates with unique mechanisms of action, potentially addressing unmet medical needs.
Check Digit Verification of cas no
The CAS Registry Mumber 253324-92-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,5,3,3,2 and 4 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 253324-92:
(8*2)+(7*5)+(6*3)+(5*3)+(4*2)+(3*4)+(2*9)+(1*2)=124
124 % 10 = 4
So 253324-92-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N2O/c1-13-7-6-8-4-2-3-5-9(8)10(12)11(13)14/h2-5,10H,6-7,12H2,1H3/t10-/m0/s1
253324-92-4Relevant academic research and scientific papers
METHOD FOR PRODUCING BENZAZEPINONE
-
Page/Page column 18, (2008/12/04)
It is an object of the present invention to provide 2-iminocarboxylic acid derivatives, and a practically suitable industrial method for producing benzazepinones in a short process under mild conditions. The present invention provides a method for producing a benzazepinone or a salt thereof, which comprises opening a ring of an isoquinoline derivative and subsequently converting the thus generated amine into a benzazepinone through lactamization reaction.
Classical and dynamic resolution of 1-amino-3-methyl-1,3,4,5- tetrahydrobenzo[d]azepin-2-one
Mitchell, David,Hay, Lynne A.,Koenig, Thomas M.,McDaniel, Stacey,Nissen, Jeffrey S.,Audia, James E.
, p. 3814 - 3819 (2007/10/03)
Two efficient production processes of enantioenriched 1-amino-3-methyl-1,3, 4,5-tetrahydro-benzo[d]azepin-2-one 1 were achieved using the readily available starting materials. A key step in the methodologies is a classical resolution or a dynamic resolution that provides excellent chemical (>80%) yields and enantiomeric excesses (>99.8% ee). The classical resolution was developed on a preparative scale while the dynamic resolution was implemented on a pilot plant scale.