25526-81-2 Usage
Uses
Used in Pharmaceutical Industry:
4-Pyrimidinamine, 5-(bromomethyl)-2-methyl(9CI) is utilized as a key intermediate in the synthesis of pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications, including the treatment of various diseases and disorders.
Used in Agrochemical Industry:
In the agrochemical sector, 4-Pyrimidinamine, 5-(bromomethyl)-2-methyl(9CI) serves as a building block for the creation of novel agrochemicals. Its functional groups enable the production of compounds with pesticidal properties, contributing to the development of more effective and environmentally friendly crop protection solutions.
Used in Chemical Research:
4-Pyrimidinamine, 5-(bromomethyl)-2-methyl(9CI) is also employed in chemical research as a model compound for studying the reactivity and properties of pyrimidine derivatives. This helps in understanding the underlying mechanisms of various chemical reactions and contributes to the advancement of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 25526-81-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,5,2 and 6 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 25526-81:
(7*2)+(6*5)+(5*5)+(4*2)+(3*6)+(2*8)+(1*1)=112
112 % 10 = 2
So 25526-81-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H8BrN3/c1-4-9-3-5(2-7)6(8)10-4/h3H,2H2,1H3,(H2,8,9,10)
