25836-11-7 Usage
Uses
Used in Pharmaceutical Industry:
3,4-Dichloroquinoline is used as a chemical intermediate for the synthesis of various biologically active compounds, including drugs, due to its potential to contribute to the development of new pharmaceuticals with enhanced therapeutic properties.
Used in Agrochemical Industry:
3,4-Dichloroquinoline is used as a precursor in the production of pesticides, leveraging its chemical structure to create agrochemicals that can effectively control pests and diseases in agriculture.
Used in Organic Synthesis:
3,4-Dichloroquinoline is used as a building block for creating complex molecules and heterocyclic compounds, which are essential in the development of advanced organic materials and chemical entities with specific applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 25836-11-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,8,3 and 6 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 25836-11:
(7*2)+(6*5)+(5*8)+(4*3)+(3*6)+(2*1)+(1*1)=117
117 % 10 = 7
So 25836-11-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H5Cl2N/c10-7-5-12-8-4-2-1-3-6(8)9(7)11/h1-5H
