2613-32-3 Usage
Uses
Used in Pharmaceutical Industry:
2-CHLORO-4,5-DIFLUOROANILINE serves as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with specific therapeutic properties, contributing to the advancement of medicinal chemistry.
Used in Pesticide Industry:
In the realm of agriculture, 2-CHLORO-4,5-DIFLUOROANILINE is utilized as an intermediate in the production of pesticides. Its chemical properties enable the creation of effective compounds designed to protect crops from pests and diseases, thereby supporting food security and agricultural productivity.
Used in Dye Industry:
2-CHLORO-4,5-DIFLUOROANILINE is also employed in the dye industry, where it is used as an intermediate for synthesizing dyes with specific color characteristics and properties. These dyes find applications in various sectors, including textiles, plastics, and printing inks.
Used in Specialty Chemicals and Organic Compounds Production:
2-CHLORO-4,5-DIFLUOROANILINE plays a significant role in the synthesis of specialty chemicals and organic compounds, which are used across a broad spectrum of industries. Its versatility in chemical reactions allows for the development of innovative products with tailored properties for specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 2613-32-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,6,1 and 3 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 2613-32:
(6*2)+(5*6)+(4*1)+(3*3)+(2*3)+(1*2)=63
63 % 10 = 3
So 2613-32-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H4ClF2N/c7-3-1-4(8)5(9)2-6(3)10/h1-2H,10H2
