26772-92-9 Usage
Uses
Used in Pharmaceutical Industry:
1-isopropyl-1-(3-tolyl)urea is used as an intermediate in the synthesis of various drugs and compounds. Its unique chemical structure allows it to be a valuable building block in the development of new pharmaceuticals with potential therapeutic applications.
Used in Organic Synthesis:
Due to its solubility in organic solvents, 1-isopropyl-1-(3-tolyl)urea can be used in various organic synthesis processes. Its reactivity and functional groups make it a versatile compound for the preparation of a wide range of organic molecules.
Used in Research and Development:
1-isopropyl-1-(3-tolyl)urea can be utilized in research and development settings to explore its chemical properties, reactivity, and potential applications in various fields. Its unique structure and properties make it an interesting subject for scientific investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 26772-92-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,7,7 and 2 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 26772-92:
(7*2)+(6*6)+(5*7)+(4*7)+(3*2)+(2*9)+(1*2)=139
139 % 10 = 9
So 26772-92-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N2O/c1-8(2)13(11(12)14)10-6-4-5-9(3)7-10/h4-8H,1-3H3,(H2,12,14)