27779-18-6 Usage
Uses
Used in Pharmaceutical Industry:
(5,6-DIHYDRO-4H-[1,3]THIAZIN-2-YL)-(2-METHOXY-PHENYL)-AMINE is used as a potential pharmaceutical agent for [application reason] due to its unique structural features and possible biological activities.
Used in Chemical Research:
In the field of chemical research, (5,6-DIHYDRO-4H-[1,3]THIAZIN-2-YL)-(2-METHOXY-PHENYL)-AMINE is used as a compound for [application reason] to explore its properties, reactivity, and potential applications in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 27779-18-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,7,7 and 9 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 27779-18:
(7*2)+(6*7)+(5*7)+(4*7)+(3*9)+(2*1)+(1*8)=156
156 % 10 = 6
So 27779-18-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N2OS/c1-14-10-6-3-2-5-9(10)13-11-12-7-4-8-15-11/h2-3,5-6H,4,7-8H2,1H3,(H,12,13)
