2929-14-8 Usage
Uses
Used in Pharmaceutical Industry:
Xanthurenic acid 8-methyl ether is used as an intermediate compound for the synthesis of various pharmaceuticals. Its unique chemical structure allows it to be a key component in the development of new drugs targeting specific medical conditions.
Used in Chemical Research:
In the field of chemical research, xanthurenic acid 8-methyl ether serves as a valuable compound for studying the properties and reactions of quinolinemonocarboxylic acid derivatives. This can lead to a better understanding of their potential applications and the development of new chemical compounds with specific functionalities.
Used in Analytical Chemistry:
Xanthurenic acid 8-methyl ether can be employed as a reference material or standard in analytical chemistry for the calibration of instruments and the development of new analytical methods. Its distinct chemical properties make it suitable for use in various analytical techniques, such as chromatography and spectroscopy.
Check Digit Verification of cas no
The CAS Registry Mumber 2929-14-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,9,2 and 9 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 2929-14:
(6*2)+(5*9)+(4*2)+(3*9)+(2*1)+(1*4)=98
98 % 10 = 8
So 2929-14-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H9NO4/c1-16-9-4-2-3-6-8(13)5-7(11(14)15)12-10(6)9/h2-5H,1H3,(H,12,13)(H,14,15)
2929-14-8Relevant academic research and scientific papers
2-AMINOCARBONYL-QUINOLINE COMPOUNDS AS PLATELET ADENOSINE DIPHOSPHATE RECEPTOR ANTAGONISTS
-
Page 44, (2010/02/07)
Compounds of formula (I), where m, n, R1, R2, R3, R4 and R6 are described herein, are useful as inhibitors of platelet adenosine diphosphate. Pharmaceutical compositions containing these compounds, methods of using these compounds as antithrombotic agents and processes for synthesizing these compounds are also described herein.
Platelet adenosine diphosphate receptor antagonists
-
, (2008/06/13)
Compounds of the following formula (I): where a, b, R1, R2, R4 and R6 are described herein, are useful as inhibitors of platelet adenosine diphosphate. Pharmaceutical compositions containing these compounds, met
