294874-70-7 Usage
Uses
Since the provided materials do not specify any particular applications for 3-METHYL-5-(2-OXO-PROPYL)-1-PHENYL-1 H-PYRAZOLE-4-CARBOXYLIC ACID, it is not possible to list its uses based on the given information. However, given its chemical structure, it may have potential applications in various fields such as pharmaceuticals, materials science, or as an intermediate in chemical synthesis. Further research and experimentation would be necessary to determine its specific uses and benefits in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 294874-70-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,9,4,8,7 and 4 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 294874-70:
(8*2)+(7*9)+(6*4)+(5*8)+(4*7)+(3*4)+(2*7)+(1*0)=197
197 % 10 = 7
So 294874-70-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H14N2O3/c1-9(17)8-12-13(14(18)19)10(2)15-16(12)11-6-4-3-5-7-11/h3-7H,8H2,1-2H3,(H,18,19)/p-1
