2996-31-8 Usage
General Description
2-Fluoro-4-iodonitrobenzene is a chemical compound with the molecular formula C6H3FNO2I. It is a nitrobenzene derivative that contains both fluorine and iodine atoms. 2-Fluoro-4-iodonitrobenzene is typically used in organic synthesis as a building block for creating more complex molecules. It is commonly employed in the pharmaceutical and agrochemical industries for the production of various drugs and pesticides. Additionally, 2-Fluoro-4-iodonitrobenzene is also used in academic research as a reagent for studying chemical reactions and mechanisms. Due to its unique chemical structure, this compound exhibits specific reactivity and properties that make it valuable in various synthetic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 2996-31-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,9,9 and 6 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 2996-31:
(6*2)+(5*9)+(4*9)+(3*6)+(2*3)+(1*1)=118
118 % 10 = 8
So 2996-31-8 is a valid CAS Registry Number.
InChI:InChI=1S/C6H3FINO2/c7-5-3-4(8)1-2-6(5)9(10)11/h1-3H
2996-31-8Relevant articles and documents
Synthesis of Aryldiazoacetates through Palladium(0)-Catalyzed Deacylative Cross-Coupling of Aryl Iodides with Acyldiazoacetates
Ye, Fei,Wang, Chengpeng,Zhang, Yan,Wang, Jianbo
supporting information, p. 11625 - 11628 (2016/02/19)
Palladium(0)-catalyzed deacylative cross-coupling of aryl iodides and acyldiazocarbonyl compounds can be achieved at room temperature under mild reaction conditions. The coupling reaction represents a highly efficient and general method for the synthesis of aryldiazocarbonyl compounds, which have found wide and increasing applications as precursors for generating donor/acceptor-substituted metallocarbenes.
