2996-31-8 Usage
Uses
Used in Pharmaceutical Industry:
2-Fluoro-4-iodonitrobenzene serves as a crucial building block in organic synthesis, particularly for the development of complex molecules that form the basis of various drugs. Its unique structure contributes to the creation of pharmaceuticals with specific therapeutic properties, making it an indispensable component in drug discovery and design.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Fluoro-4-iodonitrobenzene is utilized for the synthesis of pesticides. Its chemical composition allows for the production of compounds that can effectively control, repel, or kill pests, thereby playing a significant role in crop protection and ensuring agricultural productivity.
Used in Academic Research:
2-Fluoro-4-iodonitrobenzene also finds application in academic research settings as a reagent. It is employed to study and understand various chemical reactions and mechanisms, providing insights into the behavior of molecules under different conditions and contributing to the advancement of chemical knowledge.
Check Digit Verification of cas no
The CAS Registry Mumber 2996-31-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,9,9 and 6 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 2996-31:
(6*2)+(5*9)+(4*9)+(3*6)+(2*3)+(1*1)=118
118 % 10 = 8
So 2996-31-8 is a valid CAS Registry Number.
InChI:InChI=1S/C6H3FINO2/c7-5-3-4(8)1-2-6(5)9(10)11/h1-3H
2996-31-8Relevant academic research and scientific papers
Synthesis of Aryldiazoacetates through Palladium(0)-Catalyzed Deacylative Cross-Coupling of Aryl Iodides with Acyldiazoacetates
Ye, Fei,Wang, Chengpeng,Zhang, Yan,Wang, Jianbo
supporting information, p. 11625 - 11628 (2016/02/19)
Palladium(0)-catalyzed deacylative cross-coupling of aryl iodides and acyldiazocarbonyl compounds can be achieved at room temperature under mild reaction conditions. The coupling reaction represents a highly efficient and general method for the synthesis of aryldiazocarbonyl compounds, which have found wide and increasing applications as precursors for generating donor/acceptor-substituted metallocarbenes.
