31457-07-5 Usage
Uses
Used in Pharmaceutical Industry:
2-METHYLBENZOFURAN-7-CARBOXYLIC ACID is used as a building block for the synthesis of various drugs and pharmaceutical intermediates, contributing to the development of new therapeutic agents.
Used in Biological Research:
2-METHYLBENZOFURAN-7-CARBOXYLIC ACID is used as a fluorescent probe for monitoring biological processes, providing insights into cellular functions and mechanisms.
Used in Medicine:
2-METHYLBENZOFURAN-7-CARBOXYLIC ACID is studied for its potential biological activities, including anti-inflammatory and anticancer properties, offering therapeutic benefits in the treatment of various diseases.
Overall, 2-Methylbenzofuran-7-carboxylic acid is a versatile chemical with diverse applications in the fields of medicine, biology, and materials science, making it a valuable compound for research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 31457-07-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,1,4,5 and 7 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 31457-07:
(7*3)+(6*1)+(5*4)+(4*5)+(3*7)+(2*0)+(1*7)=95
95 % 10 = 5
So 31457-07-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H8O3/c1-6-5-7-3-2-4-8(10(11)12)9(7)13-6/h2-5H,1H3,(H,11,12)
31457-07-5Relevant academic research and scientific papers
Benzo-furan derivative
-
, (2008/06/13)
Novel benzo-furan(or -thiophene) derivative of the formula: STR1 wherein R1 is hydrogen atom, a lower alkyl group, a cycloalkyl group, a phenyl-lower alkyl group or a substituted or unsubstituted phenyl group, R2 is hydrogen atom, a lower alkyl group, an acyl group or phenyl group, R3 is hydrogen atom, a halogen atom, nitro group, a lower alkoxy group, amino group or an acylamino group, R4 is a group of the formula: STR2 A is a lower alkylene group optionally substituted with hydroxy group, B is single bond or a lower alkylene group, one of R5 and R6 is hydrogen atom or a lower alkyl group and the other is a lower alkyl group or a phenyl-lower alkyl group, or R5 and R6 combine together with adjacent nitrogen atom to form a heteromonocyclic group, R7 is a lower alkyl group, X is oxygen atom or sulfur atom, Y is oxygen atom, imino group, a lower alkylimino group or a phenyl-lower alkylimino group and a salt thereof are disclosed. Said compound (I) and a salt thereof have a potent inhibitory activity against reflective contraction of urinary bladder.
