3184-71-2 Usage
Uses
Used in Organic Synthesis:
3-Chloro-6-isopropoxypyridazine is used as a building block in organic synthesis for its ability to contribute to the formation of complex organic molecules, facilitating the creation of a wide range of chemical products.
Used in Pharmaceutical Research:
In pharmaceutical research, 3-CHLORO-6-ISOPROPOXYPYRIDAZINE is used as a precursor for the synthesis of biologically active compounds, playing a crucial role in the development of new drugs and medicinal agents.
Used in Agrochemical Development:
3-CHLORO-6-ISOPROPOXYPYRIDAZINE is utilized in the development of agrochemicals, serving as a key component in the synthesis of compounds that can enhance crop protection and management.
Used in Corrosion Inhibition:
3-CHLORO-6-ISOPROPOXYPYRIDAZINE is studied for its potential use as a corrosion inhibitor in industrial applications, where its water-insoluble properties may contribute to the protection of materials from corrosive environments.
Used in Environmental and Health Hazards Research:
Due to its potential health and environmental hazards, 3-CHLORO-6-ISOPROPOXYPYRIDAZINE is also used in research aimed at understanding and mitigating its risks, ensuring the safe handling and application of this chemical compound in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 3184-71-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,1,8 and 4 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 3184-71:
(6*3)+(5*1)+(4*8)+(3*4)+(2*7)+(1*1)=82
82 % 10 = 2
So 3184-71-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H9ClN2O/c1-5(2)11-7-4-3-6(8)9-10-7/h3-5H,1-2H3
3184-71-2Relevant academic research and scientific papers
HYDROXYQUINOXALINECARBOXAMIDE DERIVATIVE
-
Page/Page column 78, (2010/12/29)
The present invention provides a novel hydroxyquinoxaline carboxamide derivative that is useful for preventing and/or treating blood coagulation disorders. A compound represented by formula (i), or a pharmacologically acceptable salt thereof: wherein, each of R1 and R2 independently represents a group such as a hydrogen atom or a halogen atom; R3 represents a group such as a hydrogen atom; each of R4 and R5 independently represents a group such as a hydrogen atom, a halogen atom or a C1-4 alkyl group; each of R6 and R7 independently represents a hydrogen atom or a C1-4 alkyl group; X represents a group such as a C3-10 cycloalkyl group, C6-10 aryl group or a 5- to 10-membered heterocyclic group, which may be substituted with substituent(s) selected from substituent group α; Y represents a group such as -CO-, -O- or -NRa-, and Ra represents a group such as a hydrogen atom or a C1-4 alkyl group.
Delta 1-pyrrolines used as pesticides
-
, (2008/06/13)
Novel Δ1-pyrrolines of the formula (I) in which R1, R2, R3, m and Q have the meanings given in the description, a plurality of processes for preparing these substances and their use for controlling pests.
