324-42-5 Usage
Description
2-Fluoro-6-methylnaphthalene, with the molecular formula C11H9F, is a chemical compound derived from naphthalene. It features a naphthalene ring with a fluorine atom at the 2nd position and a methyl group at the 6th position, making it a valuable intermediate in various chemical syntheses.
Uses
Used in Pharmaceutical Industry:
2-Fluoro-6-methylnaphthalene is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with improved properties, such as enhanced efficacy, selectivity, and reduced side effects.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Fluoro-6-methylnaphthalene serves as a precursor for the production of various agrochemicals, including pesticides and herbicides. Its incorporation into these compounds can lead to more effective and targeted pest control, benefiting agricultural productivity and crop protection.
Used in Dye Industry:
2-Fluoro-6-methylnaphthalene is utilized in the synthesis of dyes, particularly those with specific color properties and stability. Its presence in dye molecules can enhance colorfastness, lightfastness, and resistance to environmental factors, making it suitable for various applications, such as textiles, plastics, and printing inks.
Used as a Precursor for Fluorinated Compounds:
2-Fluoro-6-methylnaphthalene also serves as a precursor for the preparation of other fluorinated compounds. The introduction of fluorine atoms into organic molecules can significantly alter their physical and chemical properties, leading to the development of new materials with unique characteristics and applications in various industries.
Safety Considerations:
As a flammable liquid, 2-Fluoro-6-methylnaphthalene requires proper handling and safety measures to minimize risks to health and the environment. Adequate precautions should be taken during its production, storage, and use to ensure the safety of workers and the surrounding ecosystem.
Check Digit Verification of cas no
The CAS Registry Mumber 324-42-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,2 and 4 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 324-42:
(5*3)+(4*2)+(3*4)+(2*4)+(1*2)=45
45 % 10 = 5
So 324-42-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H9F/c1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-7H,1H3
324-42-5Relevant articles and documents
Antihyperglycemic Activity of Novel Naphthalenyl 3H-1,2,3,5-Oxathiadiazole 2-Oxides
Ellingboe, John W.,Lombardo, Louis J.,Alessi, Thomas R.,Nguyen, Thomas T.,Guzzo, Frieda,et al.
, p. 2485 - 2493 (2007/10/02)
A series of naphthalenyl 3H-1,2,3,5-oxathiadiazole 2-oxides was prepared and tested for antihyperglycemic activity in the db/db mouse, a model for type 2 (non-insulin dependent) diabetes mellitus.Substitution at the 1-,5-, or 8-positions of the naphthalene ring with a halogen was found to be beneficial to antihyperglycemic activity. 4--3H-1,2,3,5-oxathiadiazole 2-oxide (45), one of the most potent compounds in this series, was selected for further pharmacological evaluation.
HETEROCYCLIC DERIVATIVES
-
, (2008/06/13)
The invention concerns a heterocyclic derivative of the formula I, or a pharmaceutically-acceptable salt there of. The compounds of the invention are inhibitors of the enzyme 5-lipoxygenase.
Xi:Irritant;
