326-78-3 Usage
General Description
3-Fluoro-4-N-Octyloxybenzoic Acid is a chemical compound that combines elements of fluorine, oxygen, and benzoic acid. As its name indicates, it has a fluorine atom, an octyloxy group, and a carboxylic acid typically found in benzene, attached to its molecular structure. It is an example of fluoroaromatic compounds, which are commonly used in materials science, pharmaceuticals, and chemical research due to their unique properties like high stability, low polarity, and bioactivity. Its exact properties, including melting point, boiling point, toxicity, and environmental impact, among others, may vary depending on its specific chemical structure and the presence of other functional groups. The detailed information about this particular compound, such as its applications, safety measures, and regulatory details, might not be readily available, identifying its specificity and potential use in niche scientific research fields.
Check Digit Verification of cas no
The CAS Registry Mumber 326-78-3 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,2 and 6 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 326-78:
(5*3)+(4*2)+(3*6)+(2*7)+(1*8)=63
63 % 10 = 3
So 326-78-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H21FO3/c1-2-3-4-5-6-7-10-19-14-9-8-12(15(17)18)11-13(14)16/h8-9,11H,2-7,10H2,1H3,(H,17,18)
326-78-3Relevant articles and documents
Influence of fluoro substituents on the mesophase behaviour of banana-shaped molecules
Bedel,Rouillon,Marcerou,Laguerre,Nguyen,Achard
, p. 2214 - 2220 (2007/10/03)
Three new series of bent-shaped five-ring liquid crystals, based on the ester of isophthalic acid as the central core and azomethine linkages, are presented. They differ by the number and the position of halogeno substituents on the outer rings. This lateral substitution strongly influences the type of mesophases formed. Calculations were performed to determine the modification of the distribution of charge along the different molecules.
