32923-88-9 Usage
Uses
Used in Pharmaceutical Industry:
3-Isobutoxy propylamine is used as a raw material for the production of pharmaceuticals, contributing to the development of various medications due to its chemical properties that facilitate the synthesis of active pharmaceutical ingredients.
Used in Pesticide Industry:
In the pesticide industry, 3-Isobutoxy propylamine is utilized as a starting material for the synthesis of different types of pesticides, enhancing their effectiveness in controlling and eliminating pests.
Used in Rubber Chemical Industry:
3-Isobutoxy propylamine is employed as a component in the production of rubber chemicals, which are essential for improving the performance and durability of rubber products.
Used in Surfactant Synthesis:
As an intermediate in the synthesis of surfactants, 3-Isobutoxy propylamine plays a crucial role in creating compounds that lower the surface tension between liquids and solids, which has applications in various industries such as detergents, cosmetics, and industrial processes.
Used in Organic Compound Synthesis:
3-Isobutoxy propylamine is used as an intermediate in the synthesis of other organic compounds, highlighting its importance in organic chemistry and its ability to contribute to the creation of a wide range of chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 32923-88-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,2,9,2 and 3 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 32923-88:
(7*3)+(6*2)+(5*9)+(4*2)+(3*3)+(2*8)+(1*8)=119
119 % 10 = 9
So 32923-88-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H17NO/c1-7(2)6-9-5-3-4-8/h7H,3-6,8H2,1-2H3/p+1
