33669-70-4 Usage
Uses
Used in Pharmaceutical Industry:
4,7-Dihydroxypteridine is used as a precursor for the synthesis of pteridine-based drugs and dyes, contributing to the development of novel therapeutic agents and colorants.
Used in Neurotransmitter Synthesis:
4,7-Dihydroxypteridine is used as a key intermediate in the biosynthesis of tetrahydrobiopterin, which acts as a cofactor for enzymes involved in the synthesis of neurotransmitters, such as dopamine, serotonin, and norepinephrine. This makes it essential for maintaining proper neurotransmission and brain function.
Used in Nitric Oxide Production:
4,7-Dihydroxypteridine is used in the production of tetrahydrobiopterin, which is a crucial cofactor for the enzyme nitric oxide synthase. This enzyme is responsible for the synthesis of nitric oxide, a molecule with various physiological roles, including vasodilation, immune response, and neurotransmission.
Used in Research and Development:
4,7-Dihydroxypteridine is used as a subject of research to explore its chemical properties, biological significance, and potential applications in various fields, such as drug discovery, diagnostics, and therapeutics. This research can lead to the development of new drugs, therapies, and technologies based on the unique properties of 4,7-Dihydroxypteridine.
Check Digit Verification of cas no
The CAS Registry Mumber 33669-70-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,6,6 and 9 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 33669-70:
(7*3)+(6*3)+(5*6)+(4*6)+(3*9)+(2*7)+(1*0)=134
134 % 10 = 4
So 33669-70-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H4N4O2/c11-3-1-7-4-5(10-3)8-2-9-6(4)12/h1-2H,(H2,8,9,10,11,12)
