3401-37-4 Usage
General Description
Z-CYS(BZL)-ONP is a chemical compound often used in scientific research, particularly in biochemistry and molecular biology studies. The term stands for Z-Cysteine(Benzyl)-o-Nitrophenyl Ester. It is used as a reagent and plays a crucial role in the synthesis and analysis of proteins and peptides. Its properties allow it to react under certain conditions, making it instrumental in lab tests and studies. However, detailed information regarding its toxicity, safety measures, physical and chemical properties remains relatively limited and usually confined to specialized scientific literature or databases, emphasizing the need for its proper handling in a controlled environment.
Check Digit Verification of cas no
The CAS Registry Mumber 3401-37-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,4,0 and 1 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 3401-37:
(6*3)+(5*4)+(4*0)+(3*1)+(2*3)+(1*7)=54
54 % 10 = 4
So 3401-37-4 is a valid CAS Registry Number.
InChI:InChI=1/C24H22N2O6S/c27-23(32-21-13-11-20(12-14-21)26(29)30)22(17-33-16-19-9-5-2-6-10-19)25-24(28)31-15-18-7-3-1-4-8-18/h1-14,22H,15-17H2,(H,25,28)