34170-21-3 Usage
Uses
Used in Pharmaceutical Industry:
2-(Methylthio)-5,6,7,8-tetrahydroquinazolin-4-ol is used as a potential pharmaceutical candidate for various applications due to its structural similarity with quinazolinone derivatives, which have been studied for their diverse biological activities. The presence of a thioether and a hydroxyl group in its structure may contribute to its reactivity and potential for forming hydrogen bonds with other molecules, making it a promising compound for further exploration in medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 34170-21-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,1,7 and 0 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 34170-21:
(7*3)+(6*4)+(5*1)+(4*7)+(3*0)+(2*2)+(1*1)=83
83 % 10 = 3
So 34170-21-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2OS/c1-13-9-10-7-5-3-2-4-6(7)8(12)11-9/h2-5H2,1H3,(H,10,11,12)
