348-64-1 Usage
Uses
Used in Pharmaceutical Industry:
2,4-DICHLORO-5-FLUOROANILINE is used as a chemical intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, 2,4-DICHLORO-5-FLUOROANILINE is utilized as a precursor in the production of agrochemicals, aiding in the creation of substances that protect crops and enhance agricultural productivity.
Used in Dye Industry:
2,4-DICHLORO-5-FLUOROANILINE is employed as a building block in the synthesis of dyes, playing a crucial role in the development of colorants for various applications.
Used in Corrosion Inhibition:
2,4-DICHLORO-5-FLUOROANILINE is studied for its potential use as a corrosion inhibitor, offering protection to materials from degradation in various industrial settings.
Used in Material Development:
2,4-DICHLORO-5-FLUOROANILINE is also considered as a building block in the development of new materials, indicating its versatility and potential applications in diverse fields.
Check Digit Verification of cas no
The CAS Registry Mumber 348-64-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,4 and 8 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 348-64:
(5*3)+(4*4)+(3*8)+(2*6)+(1*4)=71
71 % 10 = 1
So 348-64-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H4Cl2FN/c7-3-1-4(8)6(10)2-5(3)9/h1-2H,10H2
348-64-1Relevant academic research and scientific papers
INSECTICIDAL BENZAMIDINES
-
Page/Page column 85-86, (2008/06/13)
Novel benzamidines of the formula (I) and a use thereof as insecticides
