35205-76-6 Usage
Uses
Used in Fragrance Industry:
3-methylnon-2-enoic acid is used as a fragrance ingredient for its ability to contribute to the scent profiles of perfumes, soaps, and other cosmetics. Its unique olfactory properties make it a valuable component in creating distinct and appealing fragrances.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 3-methylnon-2-enoic acid serves as a key intermediate in the synthesis of various medicinal compounds. Its chemical structure allows for the development of drugs with specific therapeutic properties, enhancing the range of treatments available.
Used in Agriculture:
3-methylnon-2-enoic acid exhibits insecticidal properties, making it a potential candidate for use in agricultural applications. It can be utilized to control pests and protect crops, thereby contributing to increased agricultural productivity and crop protection strategies.
Used in Biofuel Production:
Due to its chemical structure and properties, 3-methylnon-2-enoic acid has potential applications in the production of biofuels. It can be processed and converted into renewable energy sources, offering an alternative to traditional fossil fuels and contributing to a more sustainable energy future.
However, it is crucial to handle 3-methylnon-2-enoic acid with care, as it can cause irritation to the skin, eyes, and respiratory system. Proper safety measures should be taken to minimize any adverse effects during its use and manipulation in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 35205-76-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,2,0 and 5 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 35205-76:
(7*3)+(6*5)+(5*2)+(4*0)+(3*5)+(2*7)+(1*6)=96
96 % 10 = 6
So 35205-76-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H18O2/c1-3-4-5-6-7-9(2)8-10(11)12/h8H,3-7H2,1-2H3,(H,11,12)/b9-8+
