35327-87-8 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
(2E,4Z)-4-(3-ETHYL-1,3-BENZOTHIAZOL-2(3H)-YLIDENE)-1-PHENYLBUT-2-EN-1-ONE is used as an intermediate in the synthesis of pharmaceuticals and agrochemicals due to its potential biological activities, including antioxidant, antimicrobial, and antiviral properties.
Used in Photochemical Reactions:
(2E,4Z)-4-(3-ETHYL-1,3-BENZOTHIAZOL-2(3H)-YLIDENE)-1-PHENYLBUT-2-EN-1-ONE is used as a photosensitizer in photochemical reactions, where it can generate reactive oxygen species upon light irradiation, facilitating various chemical transformations.
Used in Bioanalytical Applications:
(2E,4Z)-4-(3-ETHYL-1,3-BENZOTHIAZOL-2(3H)-YLIDENE)-1-PHENYLBUT-2-EN-1-ONE is used as a fluorescent probe in bioanalytical applications, such as the detection and quantification of specific biomolecules, due to its fluorescent properties.
Used in Drug Discovery and Development:
(2E,4Z)-4-(3-ETHYL-1,3-BENZOTHIAZOL-2(3H)-YLIDENE)-1-PHENYLBUT-2-EN-1-ONE is used as a potential therapeutic agent in drug discovery and development, as it has been reported to exhibit antitumor and anti-inflammatory activities, making it a valuable component for the development of new drugs targeting cancer and inflammatory diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 35327-87-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,3,2 and 7 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 35327-87:
(7*3)+(6*5)+(5*3)+(4*2)+(3*7)+(2*8)+(1*7)=118
118 % 10 = 8
So 35327-87-8 is a valid CAS Registry Number.
InChI:InChI=1/C19H17NOS/c1-2-20-16-11-6-7-13-18(16)22-19(20)14-8-12-17(21)15-9-4-3-5-10-15/h3-14H,2H2,1H3/b12-8+,19-14-
