35622-80-1 Usage
General Description
3,5-dichloro-2-fluoro-6-methoxy-pyridin-4-amine, also known as DCFMPA, is a chemical compound consisting of a pyridine ring with two chlorine atoms, one fluorine atom, and one methoxy group attached to it. It is an amine derivative, meaning it contains a nitrogen atom and acts as a base in chemical reactions. DCFMPA is commonly used in pharmaceutical research and drug development, particularly in the synthesis of potential anti-cancer and anti-inflammatory compounds. Its unique structure and properties make it a valuable building block for creating novel drug candidates with improved efficacy and reduced side effects. Additionally, DCFMPA may also have potential applications in other fields such as agrochemicals and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 35622-80-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,6,2 and 2 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 35622-80:
(7*3)+(6*5)+(5*6)+(4*2)+(3*2)+(2*8)+(1*0)=111
111 % 10 = 1
So 35622-80-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H5Cl2FN2O/c1-12-6-3(8)4(10)2(7)5(9)11-6/h1H3,(H2,10,11)
