367954-99-2 Usage
Uses
Used in Pharmaceutical Industry:
2,4-Difluoro-5-Methylbenzoic Acid is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drug molecules. Its presence in the molecular structure can influence the pharmacological properties, such as potency, selectivity, and metabolic stability of the final drug product.
Used in Agrochemical Industry:
In the agrochemical sector, 2,4-Difluoro-5-Methylbenzoic Acid serves as a key intermediate in the production of various agrochemicals. Its incorporation into these compounds can enhance their effectiveness in pest control and crop protection, contributing to improved agricultural yields.
Used in Organic Synthesis:
2,4-Difluoro-5-Methylbenzoic Acid is utilized as a building block in organic synthesis, particularly for the preparation of substituted benzoic acid derivatives. Its unique fluorinated and methylated structure allows for the creation of a wide range of chemical entities with diverse applications.
Used in Materials Science:
In the field of materials science, 2,4-Difluoro-5-Methylbenzoic Acid has potential applications in the development of functionalized polymers and advanced materials. Its incorporation can lead to materials with specific properties, such as enhanced thermal stability, chemical resistance, or tailored electronic characteristics, depending on the desired application.
Check Digit Verification of cas no
The CAS Registry Mumber 367954-99-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,6,7,9,5 and 4 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 367954-99:
(8*3)+(7*6)+(6*7)+(5*9)+(4*5)+(3*4)+(2*9)+(1*9)=212
212 % 10 = 2
So 367954-99-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H6F2O2/c1-4-2-5(8(11)12)7(10)3-6(4)9/h2-3H,1H3,(H,11,12)
367954-99-2Relevant articles and documents
Synthesis of nonpolar peptide nucleic acid monomers containing fluoroaromatics
Shibata,Biplab Kumar Das,Honjo,Takeuchi
, p. 1605 - 1611 (2007/10/03)
A general strategy for the synthesis of nonpolar peptide nucleic acid monomers containing fluoroaromatics (F-PNA) is described. These compounds have been designed as hybrid analogues of the difluorotoluene nucleoside, F (1) with PNA. Fluorophenylacetic ac
