3725-39-1 Usage
Description
1-Morpholinocyclododecene, a chemical compound with the molecular formula C15H27NO, is a morpholine derivative featuring a cyclic dodecane ring. Known for its unique properties and reactivity, this versatile compound serves as a valuable building block in organic synthesis, enabling the creation of diverse polymers and complex chemical structures. Its potential applications extend across industrial and pharmaceutical sectors, with ongoing research into its use as a ligand in metal-catalyzed reactions and as a component in material science.
Uses
Used in Organic Synthesis:
1-Morpholinocyclododecene is used as a building block for creating various types of polymers and complex chemical structures, leveraging its unique reactivity and properties to enhance the synthesis process.
Used in Industrial Applications:
1-Morpholinocyclododecene is utilized in the industrial sector for its potential to contribute to the development of new materials and chemical processes, thanks to its distinctive chemical characteristics.
Used in Pharmaceutical Research:
In the pharmaceutical sector, 1-Morpholinocyclododecene is studied for its potential applications, possibly including the development of new drugs or drug delivery systems, given its unique structure and reactivity.
Used in Metal-Catalyzed Reactions:
1-Morpholinocyclododecene is investigated for its potential as a ligand in metal-catalyzed reactions, where it could improve the efficiency and selectivity of such processes.
Used in Material Science Research:
As a component in material science, 1-Morpholinocyclododecene is explored for its possible contributions to the understanding and development of new materials with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 3725-39-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,7,2 and 5 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 3725-39:
(6*3)+(5*7)+(4*2)+(3*5)+(2*3)+(1*9)=91
91 % 10 = 1
So 3725-39-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H29NO/c1-2-4-6-8-10-16(11-9-7-5-3-1)17-12-14-18-15-13-17/h10H,1-9,11-15H2/b16-10+