37818-93-2 Usage
Uses
Used in Medicinal Chemistry:
N-(1-Adamantyl)ethylenediamine is used as a building block for the synthesis of various pharmaceutical compounds. Its unique adamantane structure provides stability and potential for specific interactions with biological targets, making it a valuable component in the development of new drugs.
Used in Materials Science:
N-(1-Adamantyl)ethylenediamine is employed as a component in the design and synthesis of advanced materials. Its adamantane core and ethylamine group can contribute to the formation of novel materials with unique properties, such as improved thermal stability, enhanced chemical resistance, or specific binding capabilities.
Used in Chemical Research:
N-(1-Adamantyl)ethylenediamine serves as a model compound for studying the properties and reactivity of adamantane-based compounds. Its use in research helps to advance the understanding of the adamantane family and its potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 37818-93-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,8,1 and 8 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 37818-93:
(7*3)+(6*7)+(5*8)+(4*1)+(3*8)+(2*9)+(1*3)=152
152 % 10 = 2
So 37818-93-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H22N2/c13-1-2-14-12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11,14H,1-8,13H2
37818-93-2Relevant academic research and scientific papers
MMPL3 INHIBITORS, COMPOSITIONS AND USES THEREOF
-
Paragraph 0194; 0196, (2020/06/10)
Disclosed are inhibitors of mycobacterial membrane protein MmpL3, compositions comprising the inhibitors, and methods of preparation and use thereof.
Modular synthesis of heterocyclic carbene precursors
Paczal, Attila,Benyei, Attila C.,Kotschy, Andras
, p. 5969 - 5979 (2007/10/03)
A series of N-heterocyclic carbene precursors, containing an imidazoline or tetrahydropyrimidine framework, were prepared from ω-chloroalkanoyl chlorides. The sequential attachment of nitrogen nucleophiles and subsequent ring closure gave, depending on the reagents used, either the desired dihydroimidazolium and tetrahydropyrimidinium salts or their parent heterocycles. In this latter case, the second substituent was introduced in an alkylation step. The preparation of carbene precursors bearing chiral or bulky substituents was achieved with comparable efficiency.
