38560-96-2 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-1,3-dimethyl-5-nitrobenzene is used as a key intermediate in the synthesis of pharmaceuticals for its ability to be further functionalized and incorporated into complex drug molecules. Its presence in the molecular structure can influence the pharmacokinetics and pharmacodynamics of the final drug product.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Chloro-1,3-dimethyl-5-nitrobenzene is utilized as a precursor in the production of various agrochemicals, such as pesticides and herbicides. Its chemical properties allow for the development of compounds that can effectively control and manage pests and weeds in agricultural settings.
Used in Dye Industry:
2-CHLORO-1,3-DIMETHYL-5-NITROBENZENE is also used in the dye industry as an intermediate for synthesizing dyes with specific color characteristics and properties. Its chemical structure contributes to the color intensity and stability of the resulting dyes, which are used in various applications such as textiles, plastics, and printing inks.
Used as a Chemical Reagent:
2-Chloro-1,3-dimethyl-5-nitrobenzene functions as a chemical reagent in organic synthesis, facilitating various chemical reactions due to its reactivity. It is particularly useful in the formation of new chemical bonds and the transformation of other organic compounds, broadening its applications in research and industrial processes.
Used in the Synthesis of Aromatic Compounds:
As a building block, 2-Chloro-1,3-dimethyl-5-nitrobenzene is employed in the synthesis of a range of aromatic compounds. Its structural features make it a valuable component in creating diverse aromatic molecules with potential applications in various industries, including fragrances, flavorings, and specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 38560-96-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,8,5,6 and 0 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 38560-96:
(7*3)+(6*8)+(5*5)+(4*6)+(3*0)+(2*9)+(1*6)=142
142 % 10 = 2
So 38560-96-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H8ClNO2/c1-5-3-7(10(11)12)4-6(2)8(5)9/h3-4H,1-2H3
38560-96-2Relevant academic research and scientific papers
Heteroacetic acid derivatives
-
, (2008/06/13)
Disclosed are compounds of formula STR1 wherein R is hydroxy, esterified hydroxy or etherified hydroxy; R1 is halogen, trifluoromethyl or lower alkyl; R2 is halogen, trifluoromethyl or lower alkyl; R3 is halogen, trifluoromethyl, lower alkyl, aryl, aryl-lower alkyl, cycloalkyl or cycloalkyl-lower alkyl; or R3 is the radical STR2 wherein R8 is hydrogen, lower alkyl, aryl, cycloalkyl, aryl-lower alkyl or cycloalkyl-lower alkyl; R9 is hydroxy or acyloxy; R10 represents hydrogen or lower alkyl; or R9 and R10 together represent oxo; R4 is hydrogen, halogen, trifluoromethyl or lower alkyl; X is --NR7, S or O; W is O or S; R5 represents hydrogen, lower alkyl or aryl-lower alkyl;and R6 represents hydrogen; or R5 and R6 together represent oxo provided that X represents --NR7; R7 represents hydrogen or lower alkyl; Z represents carboxyl, carboxyl derivatized as a pharmaceutically acceptable ester or as a pharmaceutically acceptable amide; and pharmaceutically acceptable salts thereof; which are useful as hypocholesteremic agents.
