39603-24-2 Usage
Uses
Used in Organic Synthesis:
5,7-Dimethylisatin is used as a key intermediate for the production of cyano-(5,7-dimethyl-2-oxo-1,2-dihydro-indol-3-ylidene)-acetic acid ethyl ester through Knoevenagel condensation with cyanoacetic acid ethyl ester. This reaction is significant in the synthesis of various organic compounds, contributing to the development of new materials and products.
Used in Pharmaceutical Industry:
5,7-Dimethylisatin plays a vital role in the pharmaceutical industry as a raw material and intermediate for the synthesis of various drugs and medicinal compounds. Its unique chemical properties allow for the creation of novel therapeutic agents, potentially leading to the development of new treatments for various diseases and conditions.
Used in Agrochemical Industry:
In the agrochemical industry, 5,7-Dimethylisatin is utilized as a starting material for the synthesis of various agrochemicals, such as pesticides and herbicides. Its versatility in chemical reactions enables the development of innovative and effective products for agricultural applications, contributing to improved crop protection and yield.
Check Digit Verification of cas no
The CAS Registry Mumber 39603-24-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,6,0 and 3 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 39603-24:
(7*3)+(6*9)+(5*6)+(4*0)+(3*3)+(2*2)+(1*4)=122
122 % 10 = 2
So 39603-24-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO2/c1-5-3-6(2)8-7(4-5)9(12)10(13)11-8/h3-4H,1-2H3,(H,11,12,13)