40401-41-0 Usage
Description
2-(3-CHLORO-PHENYL)-5-METHYL-2H-PYRAZOL-3-YLAMINE is a pyrazole derivative with the molecular formula C10H10ClN3. It features a chlorine-substituted phenyl group and a methyl group attached to the pyrazole ring, which contributes to its unique chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
2-(3-CHLORO-PHENYL)-5-METHYL-2H-PYRAZOL-3-YLAMINE is used as a key intermediate in the development of new drugs targeting specific biological pathways. Its unique chemical structure allows it to interact with various biological targets, making it a promising candidate for the creation of innovative therapeutic agents.
Used in Organic Synthesis:
2-(3-CHLORO-PHENYL)-5-METHYL-2H-PYRAZOL-3-YLAMINE serves as a building block for the creation of other compounds with similar structures or properties. Its reactivity and functional groups make it a valuable component in the synthesis of complex organic molecules, contributing to the advancement of chemical research and development.
Used in Chemical Research:
The unique chemical structure and reactivity of 2-(3-CHLORO-PHENYL)-5-METHYL-2H-PYRAZOL-3-YLAMINE make it an interesting subject for further study in the field of organic chemistry. Researchers can explore its properties, reactions, and potential applications, leading to a deeper understanding of its role in chemical processes and the development of new compounds.
Used in Chemical Biology:
2-(3-CHLORO-PHENYL)-5-METHYL-2H-PYRAZOL-3-YLAMINE's potential interactions with biological systems make it a valuable subject for study in the field of chemical biology. By examining its interactions with proteins, enzymes, and other biomolecules, researchers can gain insights into its potential applications in drug discovery and the development of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 40401-41-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,4,0 and 1 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 40401-41:
(7*4)+(6*0)+(5*4)+(4*0)+(3*1)+(2*4)+(1*1)=60
60 % 10 = 0
So 40401-41-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H10ClN3/c1-7-5-10(12)14(13-7)9-4-2-3-8(11)6-9/h2-6H,12H2,1H3
40401-41-0Relevant articles and documents
Phenoxydifluoromethyl substituted nitrogen heterocycles. Synthesis and heterocyclization reactions of ethyl 4,4-difluoro-4-phenoxyacetoacetate
Solodukhin,Peregudov,Vorontsov,Chkanikov
, p. 164 - 169 (2004)
Ethyl 4,4-difluoro-4-phenoxyacetoacetate was obtained and studied as a precursor to new heterocyclic compounds. 6-Hydroxypyrimidine, 1,3-dihydro-1,5-benzodiazepin-2-one, quinolin-2-one and 6-hydroxypyrazolo[3,4-b] pyridine derivatives containing phenoxydifluoromethyl groups were synthesized. These results make it possible to introduce aryloxydifluoromethyl substituents for the design of biologically active heterocycles.
Hexahydrospiro-pyrazolo[3,4-b]pyridine-4,1′-pyrrolo[3,2,1-ij]quinolines Derived from 5,6-dihydro-4H-pyrrolo[3,2,1-ij]quinoline-1,2-dione
Saatluo, Bahman Ebrahimi,Baradarani, Mehdi M.,Joule, John A.
, p. 1176 - 1182 (2018/03/21)
The tricyclic isatin, 5,6-dihydro-4H-pyrrolo[3,2,1-ij]quinoline-1,2-dione (1), reacts with a combination of an aryl cyanomethyl ketone 8 and a 5-amino-1-arylpyrazole 7 to generate spirocyclic products 9.
SMALL MOLECULE INHIBITORS OF MCL-1 AND USES THEREOF
-
Paragraph 0139, (2015/10/28)
This invention is in the field of medicinal chemistry. In particular, the invention relates to a new class of small-molecules having pyrazolopyridine structure which function as inhibitors of Mcl-1 protein, and their use as therapeutics for the treatment of cancer and other diseases.
