40598-72-9 Usage
Uses
Used in Pharmaceutical Industry:
3-Bromo-5-methyl (1H)indazole is used as a key intermediate in the synthesis of pharmaceuticals for its potential therapeutic properties. It serves as a building block for the development of new drugs targeting a range of medical conditions, given its unique structural features and chemical reactivity.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Bromo-5-methyl (1H)indazole is utilized as a precursor in the production of agrochemicals, such as pesticides and herbicides. Its chemical structure allows for the creation of compounds that can effectively control and manage various agricultural pests and weeds.
Used in Material Science:
3-Bromo-5-methyl (1H)indazole also finds application in material science, where it is employed in the development of novel materials with specific properties. Its unique molecular structure contributes to the creation of materials with tailored characteristics for use in various industries, including electronics, coatings, and plastics.
Used in Medicinal Chemistry Research:
As a compound with potential biological properties, 3-Bromo-5-methyl (1H)indazole is extensively used in medicinal chemistry research. It is studied for its possible therapeutic effects and mechanisms of action, contributing to the advancement of knowledge in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 40598-72-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,5,9 and 8 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 40598-72:
(7*4)+(6*0)+(5*5)+(4*9)+(3*8)+(2*7)+(1*2)=129
129 % 10 = 9
So 40598-72-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H7BrN2/c1-5-2-3-7-6(4-5)8(9)11-10-7/h2-4H,1H3,(H,10,11)
