40598-72-9 Usage
General Description
3-Bromo-5-methyl (1H)indazole is a chemical compound with the molecular formula C9H8BrN3. It is a member of the indazole class of heterocyclic compounds, which are known for their diverse range of pharmaceutical and industrial applications. This specific compound is a derivative of indazole and is characterized by the presence of a bromine atom at the 3-position and a methyl group at the 5-position of the indazole ring system. It is commonly used as a building block in the synthesis of various pharmaceuticals, agrochemicals, and materials. Additionally, 3-Bromo-5-methyl (1H)indazole has been studied for its potential biological and therapeutic properties, making it an important target for medicinal chemistry research.
Check Digit Verification of cas no
The CAS Registry Mumber 40598-72-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,5,9 and 8 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 40598-72:
(7*4)+(6*0)+(5*5)+(4*9)+(3*8)+(2*7)+(1*2)=129
129 % 10 = 9
So 40598-72-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H7BrN2/c1-5-2-3-7-6(4-5)8(9)11-10-7/h2-4H,1H3,(H,10,11)
