40838-54-8 Usage
Uses
Used in Pharmaceutical Industry:
4(1H)-Pyridazinone, 3,6-bis(chloromethyl)is used as a chemical intermediate for the production of pharmaceuticals. It contributes to the development of novel drugs and therapeutics by providing a foundation for the synthesis of complex molecular structures.
Used in Agrochemical Industry:
In the agrochemical industry, 4(1H)-Pyridazinone, 3,6-bis(chloromethyl)is utilized as a chemical intermediate for the synthesis of agrochemicals. Its role in this field is essential for the development of new compounds that can enhance crop protection and improve agricultural productivity.
Used in Organic Synthesis:
4(1H)-Pyridazinone, 3,6-bis(chloromethyl)is used as a versatile building block in organic synthesis. Its unique structure allows for the creation of a wide range of new compounds, making it an invaluable resource for researchers and chemists working in various fields of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 40838-54-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,8,3 and 8 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 40838-54:
(7*4)+(6*0)+(5*8)+(4*3)+(3*8)+(2*5)+(1*4)=118
118 % 10 = 8
So 40838-54-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H6Cl2N2O/c7-2-4-1-6(11)5(3-8)10-9-4/h1H,2-3H2,(H,9,11)
