40843-35-4 Usage
Uses
Used in Pharmaceutical Industry:
Propanoic acid, 2-[4-(2-chlorophenoxy)phenoxy]-, is utilized as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical sector, Propanoic acid, 2-[4-(2-chlorophenoxy)phenoxy]- is employed as a precursor in the production of pesticides and other agrochemicals, contributing to the development of effective solutions for crop protection and management.
Used in Material Science:
Propanoic acid, 2-[4-(2-chlorophenoxy)phenoxy]-, may have potential applications in material science, where its unique chemical structure could be leveraged to create novel materials with specific properties for various applications.
Used as a Reagent in Chemical Reactions:
Propanoic acid, 2-[4-(2-chlorophenoxy)phenoxy]also serves as a reagent in various chemical reactions, facilitating the synthesis of complex organic compounds and aiding in the advancement of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 40843-35-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,8,4 and 3 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 40843-35:
(7*4)+(6*0)+(5*8)+(4*4)+(3*3)+(2*3)+(1*5)=104
104 % 10 = 4
So 40843-35-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H13ClO4/c1-10(15(17)18)19-11-6-8-12(9-7-11)20-14-5-3-2-4-13(14)16/h2-10H,1H3,(H,17,18)
