4408-82-6 Usage
Description
Bis(2-thienyl)acetic acid is a unique chemical compound characterized by a central acetic acid molecule with two 2-thienyl groups attached to it. These 2-thienyl groups, composed of aromatic rings with four carbon atoms and one sulfur atom, impart distinctive aromatic properties and a characteristic smell. As a carboxylic acid, Bis(2-thienyl)acetic acid features a -COOH group, making it a versatile building block in organic synthesis and a precursor for more complex chemical structures. Its potential pharmaceutical applications, including anti-inflammatory and analgesic effects, highlight its significance in various fields such as chemistry, pharmaceuticals, and materials science.
Uses
Used in Organic Synthesis:
Bis(2-thienyl)acetic acid serves as a valuable building block in organic synthesis, contributing to the creation of more complex chemical structures due to its unique molecular composition.
Used in Pharmaceutical Development:
Bis(2-thienyl)acetic acid is utilized in pharmaceutical research for its potential anti-inflammatory and analgesic properties, making it a promising candidate for the development of new medications to treat pain and inflammation.
Used in Materials Science:
The distinct physical and chemical properties of Bis(2-thienyl)acetic acid, including its aromatic rings and carboxylic acid group, make it suitable for applications in materials science, where it can be employed to develop new materials with specific characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 4408-82-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,4,0 and 8 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 4408-82:
(6*4)+(5*4)+(4*0)+(3*8)+(2*8)+(1*2)=86
86 % 10 = 6
So 4408-82-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H8O2S2/c11-10(12)9(7-3-1-5-13-7)8-4-2-6-14-8/h1-6,9H,(H,11,12)
4408-82-6Relevant articles and documents
-
Schildknecht,Brown
, p. 954,956 (1955)
-
Highly regioselective lithiation of inter-ring carbon of bis(thien-2yl)methane: a general meso-elaboration protocol
Singh, Kamaljit,Sharma, Amit
experimental part, p. 3682 - 3686 (2010/07/04)
Bis(thien-2yl)methane is regioselectively lithiated at the inter-ring methylene carbon using dimsyl anion in THF at 0 °C; quenching with appropriate electrophile furnishes meso-elaborated derivatives, exclusively with synthetic advantage.
