4608-10-0 Usage
Uses
Used in Pharmaceutical Industry:
3,5-cyclohexadiene-1,2-dione, 4,5-di-4-morpholinylis utilized as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of drug candidates with diverse biological activities, contributing to the creation of new treatments for a range of medical conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 3,5-cyclohexadiene-1,2-dione, 4,5-di-4-morpholinylis employed as an intermediate for the production of agrochemicals. Its incorporation into these products can lead to the development of more effective and targeted solutions for agricultural applications.
Used in Fine Chemicals Synthesis:
3,5-cyclohexadiene-1,2-dione, 4,5-di-4-morpholinylis also used in the synthesis of fine chemicals, where its distinctive structure provides a foundation for creating specialty compounds with specific applications in various industries.
Used in Chemical Research:
3,5-cyclohexadiene-1,2-dione, 4,5-di-4-morpholinylserves as a valuable tool in chemical research, where it aids in the development of innovative synthetic methodologies. Its unique properties make it instrumental in pushing the boundaries of chemical synthesis and discovery.
Used in Disease and Disorder Treatment:
3,5-cyclohexadiene-1,2-dione, 4,5-di-4-morpholinylis under investigation for its potential therapeutic applications in treating various diseases and disorders. Its unique chemical structure and biological properties make it a promising candidate for further research and development in the medical field.
Check Digit Verification of cas no
The CAS Registry Mumber 4608-10-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,6,0 and 8 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 4608-10:
(6*4)+(5*6)+(4*0)+(3*8)+(2*1)+(1*0)=80
80 % 10 = 0
So 4608-10-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H18N2O4/c17-13-9-11(15-1-5-19-6-2-15)12(10-14(13)18)16-3-7-20-8-4-16/h9-10H,1-8H2