4718-50-7 Usage
Uses
Used in Pharmaceutical Industry:
4-Ethoxy-6-methylpyrimidine is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its reactivity and versatility make it a valuable precursor in the preparation of a wide range of drugs, contributing to the development of new therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, 4-Ethoxy-6-methylpyrimidine is utilized as a key component in the synthesis of agrochemicals. Its unique structure and properties allow it to be incorporated into the development of novel compounds with potential applications in agriculture, such as pesticides and herbicides, enhancing crop protection and yield.
Used in Material Science:
4-Ethoxy-6-methylpyrimidine also finds applications in material science, where it can be used to develop new materials with specific properties. Its chemical structure allows for the creation of innovative materials with potential uses in various industries, including electronics, coatings, and adhesives.
Used in Research and Development:
As a versatile chemical compound, 4-Ethoxy-6-methylpyrimidine is employed in research and development for the exploration of new chemical reactions and the synthesis of novel compounds. Its unique properties make it an essential tool for scientists and researchers working on the cutting edge of chemical and material science.
Check Digit Verification of cas no
The CAS Registry Mumber 4718-50-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,7,1 and 8 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 4718-50:
(6*4)+(5*7)+(4*1)+(3*8)+(2*5)+(1*0)=97
97 % 10 = 7
So 4718-50-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O/c1-3-10-7-4-6(2)8-5-9-7/h4-5H,3H2,1-2H3
