4791-22-4 Usage
Uses
Used in Pharmaceutical Industry:
1-(2-CHLORO-ACETYL)-3-METHYL-UREA is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs. Its unique structure allows for the creation of a variety of medicinal compounds, enhancing the therapeutic options available in the market.
Used in Agrochemical Industry:
In the agrochemical sector, 1-(2-CHLORO-ACETYL)-3-METHYL-UREA is utilized as an intermediate in the production of agrochemicals, such as pesticides and herbicides. Its incorporation aids in the development of effective solutions for agricultural challenges, including pest control and weed management.
Used in Organic Chemistry:
1-(2-CHLORO-ACETYL)-3-METHYL-UREA is employed as a reagent in organic chemistry reactions, facilitating various chemical transformations. Its presence in these reactions can lead to the formation of new compounds with specific properties, contributing to the advancement of organic chemistry research and applications.
Used in Organic Compounds Manufacturing:
1-(2-CHLORO-ACETYL)-3-METHYL-UREA is also used in the manufacturing of various organic compounds, where its unique structure and reactivity play a crucial role in the synthesis of a wide range of products. Its versatility in this context allows for the creation of materials with diverse applications, from industrial to consumer goods.
Check Digit Verification of cas no
The CAS Registry Mumber 4791-22-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,7,9 and 1 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 4791-22:
(6*4)+(5*7)+(4*9)+(3*1)+(2*2)+(1*2)=104
104 % 10 = 4
So 4791-22-4 is a valid CAS Registry Number.
InChI:InChI=1/C4H7ClN2O2/c1-6-4(9)7-3(8)2-5/h2H2,1H3,(H2,6,7,8,9)