490-97-1 Usage
Uses
Used in Pharmaceutical Industry:
Sodium 2-fluorobenzoate is used as a building block for the synthesis of various pharmaceutical products. Its unique chemical structure allows it to be incorporated into the development of new drugs, potentially leading to improved therapeutic outcomes.
Used in Agrochemical Industry:
In the agrochemical industry, Sodium 2-fluorobenzoate is utilized as a precursor in the production of various agrochemicals. Its properties make it suitable for the synthesis of compounds that can be used in pest control and crop protection.
Used in Chemical Research:
Sodium 2-fluorobenzoate is employed as a reagent in chemical research, where its properties can be explored and utilized in various chemical reactions. Its versatility as a building block makes it valuable in the development of new chemical compounds and materials.
Used in Specialty Chemicals Production:
Sodium 2-fluorobenzoate is used in the production of specialty chemicals, where its unique properties can be harnessed to create high-value products for specific applications. Its ability to be incorporated into various chemical structures makes it a valuable component in the synthesis of specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 490-97-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,9 and 0 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 490-97:
(5*4)+(4*9)+(3*0)+(2*9)+(1*7)=81
81 % 10 = 1
So 490-97-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H5FO2.Na/c8-6-4-2-1-3-5(6)7(9)10;/h1-4H,(H,9,10);/q;+1/p-1
490-97-1Relevant academic research and scientific papers
Electronic and steric effects: How do they work in ionic liquids? the case of benzoic acid dissociation
D'Anna, Francesca,Marullo, Salvatore,Vitale, Paola,Noto, Renato
experimental part, p. 4828 - 4834 (2010/10/04)
(Figure Presented) The need to have a measure of the strength of some substituted benzoic acids in ionic liquid solution led us to use the protonation equilibrium of sodium p-nitrophenolate as a probe reaction, which was studied by means of spectrophotometric titration at 298 K. In order to evaluate the importance of electronic effect of the substituents present on the aromatic ring, both electron-withdrawing and -donor substituents were taken into account. Furthermore, to have a measure of the importance of the steric effect of the substituents both para- and ortho-substituted benzoic acids were analyzed. The probe reaction was studied in two ionic liquids differing for the ability of the cation to give hydrogen bond and π-π interactions, namely [bm 2im][NTf2] and [bmpyrr][NTf2]. Data collected show that benzoic acids are less dissociated in ionic liquid than in water solution. Furthermore, the equilibrium constant values seem to be significantly affected by both the nature of ionic liquid cation and the structure of the acid. In particular, the ortho-steric effect seems to operate differently in water and in the aromatic ionic liquid, determining in this solvent medium a particular behavior for ortho-substituted benzoic acids.
