50996-73-1 Usage
Uses
Used in Energetic Materials Synthesis:
TNFOA is utilized as a key component in the synthesis of energetic materials and high explosives, owing to its high energy content and stability. Its powerful oxidizing nature makes it a valuable asset in the development of these advanced materials.
Used in Propellants and Pyrotechnics:
In the field of propellants and pyrotechnics, TNFOA serves as a crucial ingredient due to its ability to enhance the performance and efficiency of these systems. Its high energy release and stability make it an ideal candidate for various military and civilian applications.
Used in Detection and Sensing Agents for Chemical Warfare Agents:
TNFOA is also being studied for its potential use as a detection and sensing agent for chemical warfare agents. Its reactivity towards certain compounds allows it to be a promising candidate for the development of sensors and detection systems designed to identify and mitigate the presence of these dangerous substances.
Check Digit Verification of cas no
The CAS Registry Mumber 50996-73-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,9,9 and 6 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 50996-73:
(7*5)+(6*0)+(5*9)+(4*9)+(3*6)+(2*7)+(1*3)=151
151 % 10 = 1
So 50996-73-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H9N5O11/c1-6(16(22)23)32-17-15-9-2-7(18(24)25)4-11(20(28)29)13(9)14-10(15)3-8(19(26)27)5-12(14)21(30)31/h2-6H,1H3,(H,22,23)/t6-/m0/s1