51033-46-6 Usage
Molecular structure
The compound has a complex molecular structure, which includes multiple hydroxyl and methoxy groups attached to phenyl and xanthene moieties.
Type of compound
It is a chemical compound, specifically a derivative of benzo[a]xanthene, which is a tricyclic aromatic hydrocarbon.
Hydroxyl groups
The molecule contains several hydroxyl (-OH) groups, which contribute to its antioxidant properties and potential therapeutic applications.
Methoxy groups
The presence of methoxy (-OCH3) groups in the molecule also plays a role in its chemical properties and potential applications.
Xanthene ring
The compound contains a xanthene ring, which is a key structural feature of this class of compounds.
Antioxidant properties
Due to the presence of multiple hydroxyl groups, the compound exhibits potent antioxidant properties.
Therapeutic potential
The compound has potential therapeutic applications, as it may offer benefits in the fields of medicine and material science.
Interesting target for study
The intricate structure and functional groups present in this chemical make it an interesting target for further research and exploration in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 51033-46-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,0,3 and 3 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 51033-46:
(7*5)+(6*1)+(5*0)+(4*3)+(3*3)+(2*4)+(1*6)=76
76 % 10 = 6
So 51033-46-6 is a valid CAS Registry Number.
InChI:InChI=1/C34H28O10/c1-40-27-13-18(35)6-7-19(27)30-20-14-29(42-3)32(39)34(43-4)31(20)22-11-17-12-24(37)25(38)15-26(17)44-33(22)21(30)9-16-5-8-23(36)28(10-16)41-2/h5-8,10-15,35-38H,9H2,1-4H3
51033-46-6Relevant articles and documents
Biomimetic synthesis of santalin a,b and santarubin a,b, the major colorants of red sandalwood
Strych, Sebastian,Trauner, Dirk
, p. 9509 - 9512 (2013/09/23)
Better late than never! Almost 200 years after Pelletier's pioneering studies on the chemical constituents of red sandalwood, the major santalins and santarubins have been synthesized. This efficient approach integrates a Knochel isoflavonoid synthesis with Friedel-Crafts allylations or olefin metatheses, and a final biomimetic reaction cascade that furnishes the venerable benzoxanthenone dyes in a single operation (see scheme). Copyright