51640-52-9 Usage
Uses
Used in Pharmaceutical Industry:
2-Aminothiazole-5-carbonitrile is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure and properties make it a valuable component in the development of new drugs, particularly those targeting specific biological pathways or diseases.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Aminothiazole-5-carbonitrile serves as a key intermediate in the production of pesticides and other crop protection agents. Its incorporation into these products enhances their effectiveness in controlling pests and diseases, thereby contributing to increased agricultural productivity.
Used in Dye Manufacturing:
2-Aminothiazole-5-carbonitrile is utilized in the manufacturing of dyes due to its ability to impart color to various materials. Its chemical properties allow for the creation of dyes with specific color characteristics, making it a valuable component in the textile, printing, and other industries that rely on colorants.
Used in Rubber Chemical Production:
2-AMINOTHIAZOLE-5-CARBONITRILE is also used in the production of rubber chemicals, where it contributes to the modification of rubber properties, such as improving elasticity, durability, and resistance to environmental factors. Its presence in rubber chemicals enhances the performance and longevity of rubber products.
Used in Drug Development and Medical Research:
2-Aminothiazole-5-carbonitrile is being studied for its potential bioactivity, making it a promising candidate for drug development and medical research. Its unique structure and properties may lead to the discovery of new therapeutic agents and contribute to advancements in the treatment of various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 51640-52-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,6,4 and 0 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 51640-52:
(7*5)+(6*1)+(5*6)+(4*4)+(3*0)+(2*5)+(1*2)=99
99 % 10 = 9
So 51640-52-9 is a valid CAS Registry Number.
InChI:InChI=1/C4H3N3S/c5-1-3-2-7-4(6)8-3/h2H,(H2,6,7)
