52334-54-0 Usage
Uses
Used in Pharmaceutical Research:
3-Pyridinethiol,4-amino-(6CI,9CI) is used as a key intermediate in the synthesis of new drugs and pharmaceuticals for various therapeutic applications. Its unique chemical structure allows for the development of compounds with novel biological activities and potential therapeutic benefits.
Used in Organic Synthesis:
3-Pyridinethiol,4-amino-(6CI,9CI) is used as a building block in the synthesis of various biologically active compounds. Its presence of an amino and thiol group provides versatility in chemical reactions, enabling the formation of a wide range of organic compounds with diverse applications.
Used in Chemical Intermediates Production:
3-Pyridinethiol,4-amino-(6CI,9CI) may have potential industrial applications as a chemical intermediate in the production of other compounds. Its unique structure and functional groups make it a valuable component in the synthesis of various chemical products, contributing to the development of new materials and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 52334-54-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,3,3 and 4 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 52334-54:
(7*5)+(6*2)+(5*3)+(4*3)+(3*4)+(2*5)+(1*4)=100
100 % 10 = 0
So 52334-54-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N2S/c6-4-1-2-7-3-5(4)8/h1-3,8H,(H2,6,7)
52334-54-0Relevant academic research and scientific papers
Matsumoto, Kouzou,Nishizawa, Maho,Hirao, Yasukazu,Kurata, Hiroyuki,Kubo, Takashi
, p. 175 - 178 (2014)
A Ni(Hapt)2 complex, apt = 4-amino-3-pyridinethiolate, is isolated and characterized by X-ray crystallography, cyclic voltammetry, and UV-Vis spectroscopy.
