52864-56-9 Usage
Uses
Used in Chemical Synthesis:
(2-bromo-4-chlorophenyl)acetic acid is used as a synthetic intermediate for the production of various chemical compounds. Its unique structure allows it to be a valuable building block in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Research Applications:
In the field of scientific research, (2-bromo-4-chlorophenyl)acetic acid is used as a research compound to study its chemical properties, reactivity, and potential applications in different chemical reactions. It can also be used to investigate its interactions with other molecules and its potential as a precursor for the development of new materials.
Used in Pharmaceutical Industry:
(2-bromo-4-chlorophenyl)acetic acid is used as a key component in the development of new drugs. Its unique structure may provide specific pharmacological properties, making it a potential candidate for the treatment of various diseases. It can be used as a starting material for the synthesis of new drug molecules or as a modifier to improve the efficacy and safety of existing drugs.
Used in Agrochemical Industry:
In the agrochemical sector, (2-bromo-4-chlorophenyl)acetic acid is used as a raw material for the synthesis of new pesticides, herbicides, or other crop protection agents. Its unique structure may offer novel modes of action, leading to the development of more effective and environmentally friendly agrochemical products.
Used in Material Science:
(2-bromo-4-chlorophenyl)acetic acid can be used in the development of new materials with specific properties, such as improved thermal stability, chemical resistance, or optical characteristics. Its unique structure may contribute to the creation of advanced materials for various applications, including electronics, coatings, and composites.
Check Digit Verification of cas no
The CAS Registry Mumber 52864-56-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,8,6 and 4 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 52864-56:
(7*5)+(6*2)+(5*8)+(4*6)+(3*4)+(2*5)+(1*6)=139
139 % 10 = 9
So 52864-56-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H6BrClO2/c9-7-4-6(10)2-1-5(7)3-8(11)12/h1-2,4H,3H2,(H,11,12)
52864-56-9Relevant academic research and scientific papers
Phosphodiesters as GPR84 Antagonists for the Treatment of Ulcerative Colitis
Chen, Lin-Hai,Fang, You-Chen,Nan, Fa-Jun,Xiao, Yu-Feng,Xie, Xin,Zhang, Qing
, p. 3991 - 4006 (2022/03/14)
GPR84 is a proinflammatory G protein-coupled receptor associated with several inflammatory and fibrotic diseases. GPR84 antagonists have been evaluated in clinical trials to treat ulcerative colitis, idiopathic pulmonary fibrosis, and nonalcoholic steatohepatitis. However, the variety of potent and selective GPR84 antagonists is still limited. Through high-throughput screening, a novel phosphodiester compound hit 1 was identified as a GPR84 antagonist. The subsequent structural optimization led to the identification of compound 33 with improved potency in the calcium mobilization assay and the ability to inhibit the chemotaxis of neutrophils and macrophages upon GPR84 activation. In a DSS-induced mouse model of ulcerative colitis, compound 33 significantly alleviated colitis symptoms and reduced the disease activity index score at oral doses of 25 mg/kg qd, with an efficacy similar to that of positive control 5-aminosalicylic acid (200 mg/kg, qd, po), suggesting that compound 33 is a promising candidate for further drug development.
