5391-40-2 Usage
Uses
Used in Chemical Industry:
1,3-Diacetyl-2-imidazolidinone is used as a model compound for diisocyanate cyclopolymers. It plays a crucial role in the development and characterization of these polymers, which have a wide range of applications in various industries due to their unique properties.
In the provided materials, 1,3-Diacetyl-2-imidazolidinone is specifically mentioned for its use in characterizing model compounds for diisocyanate cyclopolymers. This indicates its importance in the research and development of new materials with potential applications in various fields, such as plastics, coatings, and elastomers.
Check Digit Verification of cas no
The CAS Registry Mumber 5391-40-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,3,9 and 1 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 5391-40:
(6*5)+(5*3)+(4*9)+(3*1)+(2*4)+(1*0)=92
92 % 10 = 2
So 5391-40-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O3/c1-5(10)8-3-4-9(6(2)11)7(8)12/h3-4H2,1-2H3