5397-75-1 Usage
Uses
Used in Pharmaceutical Industry:
2,6-Diethoxyisonicotinic acid is used as a building block for the development of new pharmaceutical compounds due to its versatile chemical structure and potential to interact with metal ions as a ligand. Its ability to form coordination complexes with metal ions can enhance the properties of certain drugs, potentially improving their efficacy and stability.
Used in Coordination Chemistry:
In the field of coordination chemistry, 2,6-Diethoxyisonicotinic acid is utilized as a ligand to form metal complexes. This application is significant for studying the interactions between metal ions and organic ligands, which can lead to the discovery of new materials with unique properties and potential uses in various industries.
Used in Synthesis of Bioactive Compounds:
2,6-Diethoxyisonicotinic acid is employed as a key intermediate in the synthesis of bioactive compounds. Its presence in the molecular structure can influence the biological activity of the resulting compounds, making it a valuable component in the development of new drugs with specific therapeutic effects.
Overall, 2,6-Diethoxyisonicotinic acid is a significant and adaptable compound with a wide range of potential pharmaceutical and chemical applications, including its role in the development of new drugs, metal ion coordination, and the synthesis of bioactive compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 5397-75-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,3,9 and 7 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5397-75:
(6*5)+(5*3)+(4*9)+(3*7)+(2*7)+(1*5)=121
121 % 10 = 1
So 5397-75-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H13NO4/c1-3-14-8-5-7(10(12)13)6-9(11-8)15-4-2/h5-6H,3-4H2,1-2H3,(H,12,13)
5397-75-1Relevant academic research and scientific papers
ANTIBACTERIAL COMPOUNDS AND USES THEREOF
-
Paragraph 0057, (2017/09/28)
The present invention relates to compounds of formula (I) including any stereochemically isomeric form thereof, or pharmaceutically acceptable salts thereof, for the treatment of tuberculosis.
